C14H18ClN5O — CID 64523585
5-chloro-2-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide (PubChem CID 64523585) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 5-chloro-2-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide.
| Compound Name | 5-chloro-2-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 64523585 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-chloro-2-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
| SMILES | CCNc1ccc(Cl)cc1C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H18ClN5O/c1-2-16-12-6-5-10(15)8-11(12)14(21)17-7-3-4-13-18-9-19-20-13/h5-6,8-9,16H,2-4,7H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | OUQPBKGETDQIGF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|