C13H18N6O — CID 105070362
3-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-4-carboxamide (PubChem CID 105070362) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 3-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-4-carboxamide.
| Compound Name | 3-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105070362 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-(ethylamino)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-4-carboxamide |
| SMILES | CCNc1cnccc1C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H18N6O/c1-2-15-11-8-14-7-5-10(11)13(20)16-6-3-4-12-17-9-18-19-12/h5,7-9,15H,2-4,6H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | XXSYBYWHSLIOIS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|