C15H23ClN2OS — CID 103529986
5-chloro-2-(ethylamino)-N-(5-methylsulfanylpentyl)benzamide (PubChem CID 103529986) has the molecular formula C15H23ClN2OS and a molecular weight of 314.88 g/mol. Its IUPAC name is 5-chloro-2-(ethylamino)-N-(5-methylsulfanylpentyl)benzamide.
| Compound Name | 5-chloro-2-(ethylamino)-N-(5-methylsulfanylpentyl)benzamide |
|---|---|
| PubChem CID | 103529986 |
| Molecular Formula | C15H23ClN2OS |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5-chloro-2-(ethylamino)-N-(5-methylsulfanylpentyl)benzamide |
| SMILES | CCNc1ccc(Cl)cc1C(=O)NCCCCCSC |
| InChI | InChI=1S/C15H23ClN2OS/c1-3-17-14-8-7-12(16)11-13(14)15(19)18-9-5-4-6-10-20-2/h7-8,11,17H,3-6,9-10H2,1-2H3,(H,18,19) |
| InChIKey | QZNZSSCNQBRULK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|