C15H24ClN3O3S — CID 91652973
5-chloro-2-(ethylamino)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide (PubChem CID 91652973) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is 5-chloro-2-(ethylamino)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide.
| Compound Name | 5-chloro-2-(ethylamino)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 91652973 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 5-chloro-2-(ethylamino)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide |
| SMILES | CCNc1ccc(Cl)cc1C(=O)NCCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C15H24ClN3O3S/c1-4-17-14-8-7-12(16)11-13(14)15(20)18-9-6-10-19(3)23(21,22)5-2/h7-8,11,17H,4-6,9-10H2,1-3H3,(H,18,20) |
| InChIKey | VXEYUWRBTJQFFS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|