C14H21ClN2O5S2 — CID 55963196
4-chloro-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-methylsulfonylbenzamide (PubChem CID 55963196) has the molecular formula C14H21ClN2O5S2 and a molecular weight of 396.92 g/mol. Its IUPAC name is 4-chloro-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55963196 |
| Molecular Formula | C14H21ClN2O5S2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-chloro-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-methylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H21ClN2O5S2/c1-4-24(21,22)17(2)9-5-8-16-14(18)11-6-7-12(15)13(10-11)23(3,19)20/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,18) |
| InChIKey | RCSJWDOKERFZJF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|