C13H21N3O3S — CID 119728935
3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide (PubChem CID 119728935) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide.
| Compound Name | 3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 119728935 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-3-20(18,19)16(2)9-5-8-15-13(17)11-6-4-7-12(14)10-11/h4,6-7,10H,3,5,8-9,14H2,1-2H3,(H,15,17) |
| InChIKey | AWOPVTUXWSGFAY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|