C18H25Cl2N3O — CID 119835670
3-amino-N-[3-[benzyl(methyl)amino]propyl]benzamide;dihydrochloride (PubChem CID 119835670) has the molecular formula C18H25Cl2N3O and a molecular weight of 370.32 g/mol. Its IUPAC name is 3-amino-N-[3-[benzyl(methyl)amino]propyl]benzamide;dihydrochloride.
| Compound Name | 3-amino-N-[3-[benzyl(methyl)amino]propyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119835670 |
| Molecular Formula | C18H25Cl2N3O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-amino-N-[3-[benzyl(methyl)amino]propyl]benzamide;dihydrochloride |
| SMILES | CN(CCCNC(=O)c1cccc(N)c1)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C18H23N3O.2ClH/c1-21(14-15-7-3-2-4-8-15)12-6-11-20-18(22)16-9-5-10-17(19)13-16;;/h2-5,7-10,13H,6,11-12,14,19H2,1H3,(H,20,22);2*1H |
| InChIKey | HUCZRKXWMOIHNL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|