C19H23N3O2 — CID 41306684
4-N-[3-[benzyl(methyl)amino]propyl]benzene-1,4-dicarboxamide (PubChem CID 41306684) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-N-[3-[benzyl(methyl)amino]propyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[3-[benzyl(methyl)amino]propyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 41306684 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-N-[3-[benzyl(methyl)amino]propyl]benzene-1,4-dicarboxamide |
| SMILES | CN(CCCNC(=O)c1ccc(C(N)=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23N3O2/c1-22(14-15-6-3-2-4-7-15)13-5-12-21-19(24)17-10-8-16(9-11-17)18(20)23/h2-4,6-11H,5,12-14H2,1H3,(H2,20,23)(H,21,24) |
| InChIKey | NZIFDUGTVDXNJG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|