C20H23N3O2S — CID 41306034
N-[3-[benzyl(methyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 41306034) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 41306034 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc2c(c1)NC(=O)CS2)Cc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-23(13-15-6-3-2-4-7-15)11-5-10-21-20(25)16-8-9-18-17(12-16)22-19(24)14-26-18/h2-4,6-9,12H,5,10-11,13-14H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | GTVOHRGOWIPUAQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|