C28H31N3OS — CID 4301347
N-[3-[benzyl(methyl)amino]propyl]-6-ethylidene-8-methyl-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 4301347) has the molecular formula C28H31N3OS and a molecular weight of 457.64 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-6-ethylidene-8-methyl-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-6-ethylidene-8-methyl-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 4301347 |
| Molecular Formula | C28H31N3OS |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-6-ethylidene-8-methyl-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CC=C1Nc2cc(C(=O)NCCCN(C)Cc3ccccc3)ccc2Sc2ccc(C)cc21 |
| InChI | InChI=1S/C28H31N3OS/c1-4-24-23-17-20(2)11-13-26(23)33-27-14-12-22(18-25(27)30-24)28(32)29-15-8-16-31(3)19-21-9-6-5-7-10-21/h4-7,9-14,17-18,30H,8,15-16,19H2,1-3H3,(H,29,32) |
| InChIKey | IYQOAOAMRKTPBL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|