C17H17N3O4S — CID 53481939
N-(2-aminoethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;formic acid (PubChem CID 53481939) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;formic acid.
| Compound Name | N-(2-aminoethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 53481939 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(2-aminoethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide;formic acid |
| SMILES | NCCNC(=O)c1ccc2c(c1)NC(=O)c1ccccc1S2.O=CO |
| InChI | InChI=1S/C16H15N3O2S.CH2O2/c17-7-8-18-15(20)10-5-6-14-12(9-10)19-16(21)11-3-1-2-4-13(11)22-14;2-1-3/h1-6,9H,7-8,17H2,(H,18,20)(H,19,21);1H,(H,2,3) |
| InChIKey | MXJDXZZMSGPJHA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|