C26H18N2O2S — CID 118373200
6-oxo-N-(3-phenylphenyl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 118373200) has the molecular formula C26H18N2O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is 6-oxo-N-(3-phenylphenyl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-oxo-N-(3-phenylphenyl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 118373200 |
| Molecular Formula | C26H18N2O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 6-oxo-N-(3-phenylphenyl)-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)c1ccc2c(c1)NC(=O)c1ccccc1S2 |
| InChI | InChI=1S/C26H18N2O2S/c29-25(27-20-10-6-9-18(15-20)17-7-2-1-3-8-17)19-13-14-24-22(16-19)28-26(30)21-11-4-5-12-23(21)31-24/h1-16H,(H,27,29)(H,28,30) |
| InChIKey | HNFJGFANIDMAJP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |