C21H14N2O3 — CID 2953655
N-(1,3-dioxoisoindol-5-yl)-4-phenylbenzamide (PubChem CID 2953655) has the molecular formula C21H14N2O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-4-phenylbenzamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 2953655 |
| Molecular Formula | C21H14N2O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14N2O3/c24-19(15-8-6-14(7-9-15)13-4-2-1-3-5-13)22-16-10-11-17-18(12-16)21(26)23-20(17)25/h1-12H,(H,22,24)(H,23,25,26) |
| InChIKey | VFYZVSCKIAJRRL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|