C19H13N3O5 — CID 17172105
N-(1,3-dioxoisoindol-5-yl)-2-ethyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17172105) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-2-ethyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-2-ethyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17172105 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-2-ethyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCN1C(=O)c2ccc(C(=O)Nc3ccc4c(c3)C(=O)NC4=O)cc2C1=O |
| InChI | InChI=1S/C19H13N3O5/c1-2-22-18(26)12-5-3-9(7-14(12)19(22)27)15(23)20-10-4-6-11-13(8-10)17(25)21-16(11)24/h3-8H,2H2,1H3,(H,20,23)(H,21,24,25) |
| InChIKey | QRHBRRKRTZPRMU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|