C26H18N4O6 — CID 169211221
N-[2-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 169211221) has the molecular formula C26H18N4O6 and a molecular weight of 482.45 g/mol. Its IUPAC name is N-[2-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[2-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 169211221 |
| Molecular Formula | C26H18N4O6 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[2-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NCCc1ccc(NC(=O)c2ccc3c(c2)C(=O)NC3=O)cc1)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C26H18N4O6/c31-21(14-3-7-17-19(11-14)25(35)29-23(17)33)27-10-9-13-1-5-16(6-2-13)28-22(32)15-4-8-18-20(12-15)26(36)30-24(18)34/h1-8,11-12H,9-10H2,(H,27,31)(H,28,32)(H,29,33,35)(H,30,34,36) |
| InChIKey | WYSBEFLEHSBZOM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|