C30H18N6O6 — CID 164728727
N-[4-[[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]diazenyl]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 164728727) has the molecular formula C30H18N6O6 and a molecular weight of 558.51 g/mol. Its IUPAC name is N-[4-[[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]diazenyl]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-[[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]diazenyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 164728727 |
| Molecular Formula | C30H18N6O6 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | N-[4-[[4-[(1,3-dioxoisoindole-5-carbonyl)amino]phenyl]diazenyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccc(NC(=O)c3ccc4c(c3)C(=O)NC4=O)cc2)cc1)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C30H18N6O6/c37-25(15-1-11-21-23(13-15)29(41)33-27(21)39)31-17-3-7-19(8-4-17)35-36-20-9-5-18(6-10-20)32-26(38)16-2-12-22-24(14-16)30(42)34-28(22)40/h1-14H,(H,31,37)(H,32,38)(H,33,39,41)(H,34,40,42)/b36-35+ |
| InChIKey | WJOVJUSUHOXSAB-ULDVOPSXSA-N |
| XLogP | 4.37 |
| TPSA | 175.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|