C17H12N2O5 — CID 4048166
[4-[(1,3-dioxoisoindol-5-yl)carbamoyl]phenyl] acetate (PubChem CID 4048166) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is [4-[(1,3-dioxoisoindol-5-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[(1,3-dioxoisoindol-5-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 4048166 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | [4-[(1,3-dioxoisoindol-5-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C17H12N2O5/c1-9(20)24-12-5-2-10(3-6-12)15(21)18-11-4-7-13-14(8-11)17(23)19-16(13)22/h2-8H,1H3,(H,18,21)(H,19,22,23) |
| InChIKey | GDXHUBZNFXTFLG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|