C31H26N2O6 — CID 10324446
[4-[[4-[[4-[(4-acetyloxybenzoyl)amino]phenyl]methyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 10324446) has the molecular formula C31H26N2O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is [4-[[4-[[4-[(4-acetyloxybenzoyl)amino]phenyl]methyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[4-[[4-[(4-acetyloxybenzoyl)amino]phenyl]methyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 10324446 |
| Molecular Formula | C31H26N2O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [4-[[4-[[4-[(4-acetyloxybenzoyl)amino]phenyl]methyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc(Cc3ccc(NC(=O)c4ccc(OC(C)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H26N2O6/c1-20(34)38-28-15-7-24(8-16-28)30(36)32-26-11-3-22(4-12-26)19-23-5-13-27(14-6-23)33-31(37)25-9-17-29(18-10-25)39-21(2)35/h3-18H,19H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | YJXZJNOHEMBYIQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|