C28H25ClN4O4 — CID 70189284
[4-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-chlorobenzamide (PubChem CID 70189284) has the molecular formula C28H25ClN4O4 and a molecular weight of 516.99 g/mol. Its IUPAC name is [4-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-chlorobenzamide.
| Compound Name | [4-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 70189284 |
| Molecular Formula | C28H25ClN4O4 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [4-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-chlorobenzamide |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc(N)cc2)cc1.Nc1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H14N2O3.C13H11ClN2O/c1-10(18)20-14-8-2-11(3-9-14)15(19)17-13-6-4-12(16)5-7-13;14-10-3-1-9(2-4-10)13(17)16-12-7-5-11(15)6-8-12/h2-9H,16H2,1H3,(H,17,19);1-8H,15H2,(H,16,17) |
| InChIKey | CLCIFWIOGBOUCY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|