C24H22ClNO4 — CID 53266246
[4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(3,5-dimethylphenoxy)propanoate (PubChem CID 53266246) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(3,5-dimethylphenoxy)propanoate.
| Compound Name | [4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(3,5-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 53266246 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [4-[(4-chlorophenyl)carbamoyl]phenyl] 2-(3,5-dimethylphenoxy)propanoate |
| SMILES | Cc1cc(C)cc(OC(C)C(=O)Oc2ccc(C(=O)Nc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C24H22ClNO4/c1-15-12-16(2)14-22(13-15)29-17(3)24(28)30-21-10-4-18(5-11-21)23(27)26-20-8-6-19(25)7-9-20/h4-14,17H,1-3H3,(H,26,27) |
| InChIKey | VLSQYXNHSSJEJC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|