About (4-chlorophenyl) acetate
(4-chlorophenyl) acetate (PubChem CID 13410) has the molecular formula C8H7ClO2
and a molecular weight of 170.59 g/mol. Its IUPAC name is (4-chlorophenyl) acetate.
Molecular Properties
| Compound Name | (4-chlorophenyl) acetate |
| PubChem CID | 13410 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | (4-chlorophenyl) acetate |
| SMILES | CC(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7ClO2/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3 |
| InChIKey | KEUPLGRNURQXAR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) acetate?
The IUPAC name of (4-chlorophenyl) acetate (CID 13410) is (4-chlorophenyl) acetate.
What is the SMILES notation for (4-chlorophenyl) acetate?
The canonical SMILES for (4-chlorophenyl) acetate is CC(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) acetate?
The InChIKey is KEUPLGRNURQXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3.
What are the key properties of (4-chlorophenyl) acetate?
(4-chlorophenyl) acetate has a molecular weight of 170.59 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) acetate is sourced from PubChem (CID 13410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).