About (4-methylphenyl) acetate;zinc
(4-methylphenyl) acetate;zinc (PubChem CID 159589232) has the molecular formula C9H10O2Zn
and a molecular weight of 215.57 g/mol. Its IUPAC name is (4-methylphenyl) acetate;zinc.
Molecular Properties
| Compound Name | (4-methylphenyl) acetate;zinc |
| PubChem CID | 159589232 |
| Molecular Formula | C9H10O2Zn |
| Molecular Weight | 215.57 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | (4-methylphenyl) acetate;zinc |
| SMILES | CC(=O)Oc1ccc(C)cc1.[Zn] |
| InChI | InChI=1S/C9H10O2.Zn/c1-7-3-5-9(6-4-7)11-8(2)10;/h3-6H,1-2H3; |
| InChIKey | MKAGSJPCBVEURQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) acetate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) acetate;zinc?
The IUPAC name of (4-methylphenyl) acetate;zinc (CID 159589232) is (4-methylphenyl) acetate;zinc.
What is the SMILES notation for (4-methylphenyl) acetate;zinc?
The canonical SMILES for (4-methylphenyl) acetate;zinc is CC(=O)Oc1ccc(C)cc1.[Zn].
What is the InChIKey of (4-methylphenyl) acetate;zinc?
The InChIKey is MKAGSJPCBVEURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.Zn/c1-7-3-5-9(6-4-7)11-8(2)10;/h3-6H,1-2H3;.
What are the key properties of (4-methylphenyl) acetate;zinc?
(4-methylphenyl) acetate;zinc has a molecular weight of 215.57 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) acetate;zinc is sourced from PubChem (CID 159589232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).