About (4-chlorophenyl) 2-oxopropanoate
(4-chlorophenyl) 2-oxopropanoate (PubChem CID 22420053) has the molecular formula C9H7ClO3
and a molecular weight of 198.60 g/mol. Its IUPAC name is (4-chlorophenyl) 2-oxopropanoate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-oxopropanoate |
| PubChem CID | 22420053 |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (4-chlorophenyl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H7ClO3/c1-6(11)9(12)13-8-4-2-7(10)3-5-8/h2-5H,1H3 |
| InChIKey | OPYXZMZBRZUOCD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-oxopropanoate?
The IUPAC name of (4-chlorophenyl) 2-oxopropanoate (CID 22420053) is (4-chlorophenyl) 2-oxopropanoate.
What is the SMILES notation for (4-chlorophenyl) 2-oxopropanoate?
The canonical SMILES for (4-chlorophenyl) 2-oxopropanoate is CC(=O)C(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) 2-oxopropanoate?
The InChIKey is OPYXZMZBRZUOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3/c1-6(11)9(12)13-8-4-2-7(10)3-5-8/h2-5H,1H3.
What are the key properties of (4-chlorophenyl) 2-oxopropanoate?
(4-chlorophenyl) 2-oxopropanoate has a molecular weight of 198.60 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-oxopropanoate is sourced from PubChem (CID 22420053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).