C29H26N2O2S2 — CID 43980966
4-methylsulfanyl-N-[4-[[4-[(4-methylsulfanylbenzoyl)amino]phenyl]methyl]phenyl]benzamide (PubChem CID 43980966) has the molecular formula C29H26N2O2S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[4-[[4-[(4-methylsulfanylbenzoyl)amino]phenyl]methyl]phenyl]benzamide.
| Compound Name | 4-methylsulfanyl-N-[4-[[4-[(4-methylsulfanylbenzoyl)amino]phenyl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 43980966 |
| Molecular Formula | C29H26N2O2S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 4-methylsulfanyl-N-[4-[[4-[(4-methylsulfanylbenzoyl)amino]phenyl]methyl]phenyl]benzamide |
| SMILES | CSc1ccc(C(=O)Nc2ccc(Cc3ccc(NC(=O)c4ccc(SC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O2S2/c1-34-26-15-7-22(8-16-26)28(32)30-24-11-3-20(4-12-24)19-21-5-13-25(14-6-21)31-29(33)23-9-17-27(35-2)18-10-23/h3-18H,19H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | FRLXZWFWGKYEGK-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |