C14H11F2NOS — CID 9153618
3,4-difluoro-N-(4-methylsulfanylphenyl)benzamide (PubChem CID 9153618) has the molecular formula C14H11F2NOS and a molecular weight of 279.31 g/mol. Its IUPAC name is 3,4-difluoro-N-(4-methylsulfanylphenyl)benzamide.
| Compound Name | 3,4-difluoro-N-(4-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 9153618 |
| Molecular Formula | C14H11F2NOS |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3,4-difluoro-N-(4-methylsulfanylphenyl)benzamide |
| SMILES | CSc1ccc(NC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H11F2NOS/c1-19-11-5-3-10(4-6-11)17-14(18)9-2-7-12(15)13(16)8-9/h2-8H,1H3,(H,17,18) |
| InChIKey | PYURSTJRVYNHDB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |