C14H11F2NOS — CID 42370376
2,5-difluoro-N-(4-methylsulfanylphenyl)benzamide (PubChem CID 42370376) has the molecular formula C14H11F2NOS and a molecular weight of 279.31 g/mol. Its IUPAC name is 2,5-difluoro-N-(4-methylsulfanylphenyl)benzamide.
| Compound Name | 2,5-difluoro-N-(4-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 42370376 |
| Molecular Formula | C14H11F2NOS |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2,5-difluoro-N-(4-methylsulfanylphenyl)benzamide |
| SMILES | CSc1ccc(NC(=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C14H11F2NOS/c1-19-11-5-3-10(4-6-11)17-14(18)12-8-9(15)2-7-13(12)16/h2-8H,1H3,(H,17,18) |
| InChIKey | WDBXOMDMBACNJF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |