C15H10F5NO — CID 24573056
2,5-difluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 24573056) has the molecular formula C15H10F5NO and a molecular weight of 315.24 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,5-difluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 24573056 |
| Molecular Formula | C15H10F5NO |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2,5-difluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(F)ccc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H10F5NO/c1-8-2-4-10(7-12(8)15(18,19)20)21-14(22)11-6-9(16)3-5-13(11)17/h2-7H,1H3,(H,21,22) |
| InChIKey | GRAIHLFDRBLCST-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |