C16H10F7NO — CID 118641910
4-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 118641910) has the molecular formula C16H10F7NO and a molecular weight of 365.25 g/mol. Its IUPAC name is 4-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118641910 |
| Molecular Formula | C16H10F7NO |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(F)c(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10F7NO/c1-8-2-4-10(7-11(8)15(18,19)20)24-14(25)9-3-5-13(17)12(6-9)16(21,22)23/h2-7H,1H3,(H,24,25) |
| InChIKey | GRTGWBULIRTOLM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |