C20H20F4N2O3 — CID 137353546
tert-butyl N-[4-fluoro-3-[[4-methyl-3-(trifluoromethyl)benzoyl]amino]phenyl]carbamate (PubChem CID 137353546) has the molecular formula C20H20F4N2O3 and a molecular weight of 412.38 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-3-[[4-methyl-3-(trifluoromethyl)benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-3-[[4-methyl-3-(trifluoromethyl)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 137353546 |
| Molecular Formula | C20H20F4N2O3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | tert-butyl N-[4-fluoro-3-[[4-methyl-3-(trifluoromethyl)benzoyl]amino]phenyl]carbamate |
| SMILES | Cc1ccc(C(=O)Nc2cc(NC(=O)OC(C)(C)C)ccc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H20F4N2O3/c1-11-5-6-12(9-14(11)20(22,23)24)17(27)26-16-10-13(7-8-15(16)21)25-18(28)29-19(2,3)4/h5-10H,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | MSUBQGZKAFISNG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |