C19H21FN2O3S — CID 78865639
tert-butyl N-[4-fluoro-3-[(4-methylsulfanylbenzoyl)amino]phenyl]carbamate (PubChem CID 78865639) has the molecular formula C19H21FN2O3S and a molecular weight of 376.45 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-3-[(4-methylsulfanylbenzoyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-3-[(4-methylsulfanylbenzoyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 78865639 |
| Molecular Formula | C19H21FN2O3S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | tert-butyl N-[4-fluoro-3-[(4-methylsulfanylbenzoyl)amino]phenyl]carbamate |
| SMILES | CSc1ccc(C(=O)Nc2cc(NC(=O)OC(C)(C)C)ccc2F)cc1 |
| InChI | InChI=1S/C19H21FN2O3S/c1-19(2,3)25-18(24)21-13-7-10-15(20)16(11-13)22-17(23)12-5-8-14(26-4)9-6-12/h5-11H,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | CKYVFRJGDAZTTI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |