C16H19FN4O3 — CID 51090415
tert-butyl N-[2-fluoro-5-[(1-methylpyrazole-4-carbonyl)amino]phenyl]carbamate (PubChem CID 51090415) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[(1-methylpyrazole-4-carbonyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[(1-methylpyrazole-4-carbonyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 51090415 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[(1-methylpyrazole-4-carbonyl)amino]phenyl]carbamate |
| SMILES | Cn1cc(C(=O)Nc2ccc(F)c(NC(=O)OC(C)(C)C)c2)cn1 |
| InChI | InChI=1S/C16H19FN4O3/c1-16(2,3)24-15(23)20-13-7-11(5-6-12(13)17)19-14(22)10-8-18-21(4)9-10/h5-9H,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | UGSVFRZHRKCCQW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |