C14H17FN2O2 — CID 107240618
tert-butyl N-[2-fluoro-5-(prop-2-ynylamino)phenyl]carbamate (PubChem CID 107240618) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-(prop-2-ynylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-(prop-2-ynylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107240618 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-(prop-2-ynylamino)phenyl]carbamate |
| SMILES | C#CCNc1ccc(F)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H17FN2O2/c1-5-8-16-10-6-7-11(15)12(9-10)17-13(18)19-14(2,3)4/h1,6-7,9,16H,8H2,2-4H3,(H,17,18) |
| InChIKey | VDORMVWJNYFGTO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|