C16H21FN4O2 — CID 107240649
tert-butyl N-[2-fluoro-5-[(1-methylimidazol-2-yl)methylamino]phenyl]carbamate (PubChem CID 107240649) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[(1-methylimidazol-2-yl)methylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[(1-methylimidazol-2-yl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 107240649 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[(1-methylimidazol-2-yl)methylamino]phenyl]carbamate |
| SMILES | Cn1ccnc1CNc1ccc(F)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H21FN4O2/c1-16(2,3)23-15(22)20-13-9-11(5-6-12(13)17)19-10-14-18-7-8-21(14)4/h5-9,19H,10H2,1-4H3,(H,20,22) |
| InChIKey | DVGMVZRECJCHBH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |