C16H19FN2O3 — CID 107240685
tert-butyl N-[2-fluoro-5-(furan-2-ylmethylamino)phenyl]carbamate (PubChem CID 107240685) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-(furan-2-ylmethylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-(furan-2-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107240685 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-(furan-2-ylmethylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NCc2ccco2)ccc1F |
| InChI | InChI=1S/C16H19FN2O3/c1-16(2,3)22-15(20)19-14-9-11(6-7-13(14)17)18-10-12-5-4-8-21-12/h4-9,18H,10H2,1-3H3,(H,19,20) |
| InChIKey | ZANCGEVCPWIZTK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |