C21H22FN3O4 — CID 86970315
tert-butyl N-[5-(1-benzofuran-2-ylmethylcarbamoylamino)-2-fluorophenyl]carbamate (PubChem CID 86970315) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is tert-butyl N-[5-(1-benzofuran-2-ylmethylcarbamoylamino)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-benzofuran-2-ylmethylcarbamoylamino)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 86970315 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | tert-butyl N-[5-(1-benzofuran-2-ylmethylcarbamoylamino)-2-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)NCc2cc3ccccc3o2)ccc1F |
| InChI | InChI=1S/C21H22FN3O4/c1-21(2,3)29-20(27)25-17-11-14(8-9-16(17)22)24-19(26)23-12-15-10-13-6-4-5-7-18(13)28-15/h4-11H,12H2,1-3H3,(H,25,27)(H2,23,24,26) |
| InChIKey | NKRSCWQDYKATCH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |