C21H19FN2O5 — CID 87046030
tert-butyl N-[2-fluoro-5-[(2-oxochromene-3-carbonyl)amino]phenyl]carbamate (PubChem CID 87046030) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[(2-oxochromene-3-carbonyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[(2-oxochromene-3-carbonyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87046030 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[(2-oxochromene-3-carbonyl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)c2cc3ccccc3oc2=O)ccc1F |
| InChI | InChI=1S/C21H19FN2O5/c1-21(2,3)29-20(27)24-16-11-13(8-9-15(16)22)23-18(25)14-10-12-6-4-5-7-17(12)28-19(14)26/h4-11H,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | CSIGRWCEBCYVAH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|