C20H22FN3O4 — CID 55768268
tert-butyl N-[5-[(3-acetamidobenzoyl)amino]-2-fluorophenyl]carbamate (PubChem CID 55768268) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is tert-butyl N-[5-[(3-acetamidobenzoyl)amino]-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(3-acetamidobenzoyl)amino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 55768268 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl N-[5-[(3-acetamidobenzoyl)amino]-2-fluorophenyl]carbamate |
| SMILES | CC(=O)Nc1cccc(C(=O)Nc2ccc(F)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C20H22FN3O4/c1-12(25)22-14-7-5-6-13(10-14)18(26)23-15-8-9-16(21)17(11-15)24-19(27)28-20(2,3)4/h5-11H,1-4H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | QRZIGXHORHZPQF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |