C20H24FN3O6S — CID 55969313
tert-butyl N-[2-fluoro-5-[[3-[methoxy(methyl)sulfamoyl]benzoyl]amino]phenyl]carbamate (PubChem CID 55969313) has the molecular formula C20H24FN3O6S and a molecular weight of 453.49 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[[3-[methoxy(methyl)sulfamoyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[[3-[methoxy(methyl)sulfamoyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55969313 |
| Molecular Formula | C20H24FN3O6S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[[3-[methoxy(methyl)sulfamoyl]benzoyl]amino]phenyl]carbamate |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)Nc2ccc(F)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C20H24FN3O6S/c1-20(2,3)30-19(26)23-17-12-14(9-10-16(17)21)22-18(25)13-7-6-8-15(11-13)31(27,28)24(4)29-5/h6-12H,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | ATJPDWMFRWYNNG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|