C16H16N2O6S — CID 9191609
N-(1,3-benzodioxol-5-yl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 9191609) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 9191609 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H16N2O6S/c1-18(22-2)25(20,21)13-5-3-4-11(8-13)16(19)17-12-6-7-14-15(9-12)24-10-23-14/h3-9H,10H2,1-2H3,(H,17,19) |
| InChIKey | VGBHWBURJSVBNR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|