C18H19ClN2O6S — CID 34276394
N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 34276394) has the molecular formula C18H19ClN2O6S and a molecular weight of 426.88 g/mol. Its IUPAC name is N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 34276394 |
| Molecular Formula | C18H19ClN2O6S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)Nc2cc3c(cc2Cl)OCCCO3)c1 |
| InChI | InChI=1S/C18H19ClN2O6S/c1-21(25-2)28(23,24)13-6-3-5-12(9-13)18(22)20-15-11-17-16(10-14(15)19)26-7-4-8-27-17/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,20,22) |
| InChIKey | ZEUQFRSMJJJSKL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|