C18H22N2O6S — CID 18198075
N-(4,5-dimethoxy-2-methylphenyl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 18198075) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 18198075 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | COc1cc(C)c(NC(=O)c2cccc(S(=O)(=O)N(C)OC)c2)cc1OC |
| InChI | InChI=1S/C18H22N2O6S/c1-12-9-16(24-3)17(25-4)11-15(12)19-18(21)13-7-6-8-14(10-13)27(22,23)20(2)26-5/h6-11H,1-5H3,(H,19,21) |
| InChIKey | VAEQYQRJFTWSJT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|