C22H18N2O5 — CID 109057628
3-N-(1,3-benzodioxol-5-yl)-1-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 109057628) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-yl)-1-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(1,3-benzodioxol-5-yl)-1-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057628 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-yl)-1-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2cccc(C(=O)Nc3ccc4c(c3)OCO4)c2)c1 |
| InChI | InChI=1S/C22H18N2O5/c1-27-18-7-3-6-16(11-18)23-21(25)14-4-2-5-15(10-14)22(26)24-17-8-9-19-20(12-17)29-13-28-19/h2-12H,13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | BTULTPBMJMLRRI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |