C21H14F2N2O4 — CID 109057767
1-N-(1,3-benzodioxol-5-yl)-3-N-(2,4-difluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 109057767) has the molecular formula C21H14F2N2O4 and a molecular weight of 396.35 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-yl)-3-N-(2,4-difluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-yl)-3-N-(2,4-difluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057767 |
| Molecular Formula | C21H14F2N2O4 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-yl)-3-N-(2,4-difluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cccc(C(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C21H14F2N2O4/c22-14-4-6-17(16(23)9-14)25-21(27)13-3-1-2-12(8-13)20(26)24-15-5-7-18-19(10-15)29-11-28-18/h1-10H,11H2,(H,24,26)(H,25,27) |
| InChIKey | NWUWRHHTHDBOHF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |