C21H15FN2O4 — CID 109057439
1-N-(1,3-benzodioxol-5-yl)-3-N-(2-fluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 109057439) has the molecular formula C21H15FN2O4 and a molecular weight of 378.36 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-yl)-3-N-(2-fluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-yl)-3-N-(2-fluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057439 |
| Molecular Formula | C21H15FN2O4 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-yl)-3-N-(2-fluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cccc(C(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C21H15FN2O4/c22-16-6-1-2-7-17(16)24-21(26)14-5-3-4-13(10-14)20(25)23-15-8-9-18-19(11-15)28-12-27-18/h1-11H,12H2,(H,23,25)(H,24,26) |
| InChIKey | LUTDVZOOLAIBGX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |