C20H13F3N2O2 — CID 109057449
3-N-(2,6-difluorophenyl)-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 109057449) has the molecular formula C20H13F3N2O2 and a molecular weight of 370.33 g/mol. Its IUPAC name is 3-N-(2,6-difluorophenyl)-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2,6-difluorophenyl)-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057449 |
| Molecular Formula | C20H13F3N2O2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-N-(2,6-difluorophenyl)-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1F)c1cccc(C(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C20H13F3N2O2/c21-14-7-1-2-10-17(14)24-19(26)12-5-3-6-13(11-12)20(27)25-18-15(22)8-4-9-16(18)23/h1-11H,(H,24,26)(H,25,27) |
| InChIKey | VMZNHLMNDKBBBU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |