C18H19FN2O2 — CID 109051535
3-N-butan-2-yl-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 109051535) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-N-butan-2-yl-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-butan-2-yl-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051535 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-N-butan-2-yl-1-N-(2-fluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(C(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C18H19FN2O2/c1-3-12(2)20-17(22)13-7-6-8-14(11-13)18(23)21-16-10-5-4-9-15(16)19/h4-12H,3H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ULOPUQXAGJEIAA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |