C18H18F2N2O2 — CID 109044182
4-N-butan-2-yl-1-N-(2,4-difluorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109044182) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 4-N-butan-2-yl-1-N-(2,4-difluorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-butan-2-yl-1-N-(2,4-difluorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109044182 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-N-butan-2-yl-1-N-(2,4-difluorophenyl)benzene-1,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H18F2N2O2/c1-3-11(2)21-17(23)12-4-6-13(7-5-12)18(24)22-16-9-8-14(19)10-15(16)20/h4-11H,3H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | WVWPKNDDTSRSNN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |