C21H16F2N2O2 — CID 109057077
1-N-(2,6-difluorophenyl)-3-N-methyl-3-N-phenylbenzene-1,3-dicarboxamide (PubChem CID 109057077) has the molecular formula C21H16F2N2O2 and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-N-(2,6-difluorophenyl)-3-N-methyl-3-N-phenylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-(2,6-difluorophenyl)-3-N-methyl-3-N-phenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057077 |
| Molecular Formula | C21H16F2N2O2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-N-(2,6-difluorophenyl)-3-N-methyl-3-N-phenylbenzene-1,3-dicarboxamide |
| SMILES | CN(C(=O)c1cccc(C(=O)Nc2c(F)cccc2F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H16F2N2O2/c1-25(16-9-3-2-4-10-16)21(27)15-8-5-7-14(13-15)20(26)24-19-17(22)11-6-12-18(19)23/h2-13H,1H3,(H,24,26) |
| InChIKey | GMNWMXDJVBATSM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |