C24H19N3O2 — CID 109057063
3-N-methyl-3-N-phenyl-1-N-quinolin-8-ylbenzene-1,3-dicarboxamide (PubChem CID 109057063) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-N-methyl-3-N-phenyl-1-N-quinolin-8-ylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-methyl-3-N-phenyl-1-N-quinolin-8-ylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057063 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-N-methyl-3-N-phenyl-1-N-quinolin-8-ylbenzene-1,3-dicarboxamide |
| SMILES | CN(C(=O)c1cccc(C(=O)Nc2cccc3cccnc23)c1)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O2/c1-27(20-12-3-2-4-13-20)24(29)19-10-5-9-18(16-19)23(28)26-21-14-6-8-17-11-7-15-25-22(17)21/h2-16H,1H3,(H,26,28) |
| InChIKey | OSGBQTPORXXKSO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |