C23H20N2O4 — CID 109057624
1-N-(3-acetylphenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 109057624) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-N-(3-acetylphenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(3-acetylphenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057624 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-N-(3-acetylphenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2cccc(C(=O)Nc3cccc(C(C)=O)c3)c2)c1 |
| InChI | InChI=1S/C23H20N2O4/c1-15(26)16-6-4-9-19(13-16)24-22(27)17-7-3-8-18(12-17)23(28)25-20-10-5-11-21(14-20)29-2/h3-14H,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | VMRZYPGIAUTGDF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |